C15H14N2O6 — CID 148623422
5-amino-2-(3-amino-4,5-dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydrochromen-4-one (PubChem CID 148623422) has the molecular formula C15H14N2O6 and a molecular weight of 318.29 g/mol. Its IUPAC name is 5-amino-2-(3-amino-4,5-dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydrochromen-4-one.
| Compound Name | 5-amino-2-(3-amino-4,5-dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 148623422 |
| Molecular Formula | C15H14N2O6 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 5-amino-2-(3-amino-4,5-dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydrochromen-4-one |
| SMILES | Nc1cc(C2Oc3cc(O)cc(N)c3C(=O)C2O)cc(O)c1O |
| InChI | InChI=1S/C15H14N2O6/c16-7-3-6(18)4-10-11(7)13(21)14(22)15(23-10)5-1-8(17)12(20)9(19)2-5/h1-4,14-15,18-20,22H,16-17H2 |
| InChIKey | NGSNYFZJCINTPC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|