C15H11O7- — CID 25200369
(2S,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-4-oxo-2,3-dihydrochromen-5-olate (PubChem CID 25200369) has the molecular formula C15H11O7- and a molecular weight of 303.25 g/mol. Its IUPAC name is (2S,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-4-oxo-2,3-dihydrochromen-5-olate.
| Compound Name | (2S,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-4-oxo-2,3-dihydrochromen-5-olate |
|---|---|
| PubChem CID | 25200369 |
| Molecular Formula | C15H11O7- |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (2S,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-4-oxo-2,3-dihydrochromen-5-olate |
| SMILES | O=C1c2c([O-])cc(O)cc2O[C@@H](c2ccc(O)c(O)c2)[C@H]1O |
| InChI | InChI=1S/C15H12O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,14-19,21H/p-1/t14-,15-/m0/s1 |
| InChIKey | CXQWRCVTCMQVQX-GJZGRUSLSA-M |
| XLogP | 0.55 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|