C19H23N5O7 — CID 176540251
2-carbamimidoyl-1,1-dimethylguanidine;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one (PubChem CID 176540251) has the molecular formula C19H23N5O7 and a molecular weight of 433.42 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-dimethylguanidine;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one.
| Compound Name | 2-carbamimidoyl-1,1-dimethylguanidine;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 176540251 |
| Molecular Formula | C19H23N5O7 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-carbamimidoyl-1,1-dimethylguanidine;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2c(O)cc(O)cc2OC(c2ccc(O)c(O)c2)C1O.[H]/N=C(N)/N=C(\N)N(C)C |
| InChI | InChI=1S/C15H12O7.C4H11N5/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6;1-9(2)4(7)8-3(5)6/h1-5,14-19,21H;1-2H3,(H5,5,6,7,8) |
| InChIKey | GOTXSBNJVLMOIR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 218.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|