C20H20O10 — CID 163058861
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)-2,3-dihydrochromen-4-one (PubChem CID 163058861) has the molecular formula C20H20O10 and a molecular weight of 420.37 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 163058861 |
| Molecular Formula | C20H20O10 |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2c(O)cc(O)cc2OC(c2ccc(O)c(O)c2)C1C1OCC(O)C(O)C1O |
| InChI | InChI=1S/C20H20O10/c21-8-4-11(24)14-13(5-8)30-19(7-1-2-9(22)10(23)3-7)15(17(14)27)20-18(28)16(26)12(25)6-29-20/h1-5,12,15-16,18-26,28H,6H2 |
| InChIKey | AEBJLSZUGNJIOA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|