C15H11O7- — CID 90658763
(2S)-7-hydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-5-olate (PubChem CID 90658763) has the molecular formula C15H11O7- and a molecular weight of 303.25 g/mol. Its IUPAC name is (2S)-7-hydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-5-olate.
| Compound Name | (2S)-7-hydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-5-olate |
|---|---|
| PubChem CID | 90658763 |
| Molecular Formula | C15H11O7- |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (2S)-7-hydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-5-olate |
| SMILES | O=C1C[C@@H](c2cc(O)c(O)c(O)c2)Oc2cc(O)cc([O-])c21 |
| InChI | InChI=1S/C15H12O7/c16-7-3-8(17)14-9(18)5-12(22-13(14)4-7)6-1-10(19)15(21)11(20)2-6/h1-4,12,16-17,19-21H,5H2/p-1/t12-/m0/s1 |
| InChIKey | USQXPEWRYWRRJD-LBPRGKRZSA-M |
| XLogP | 1.29 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|