C16H14O8 — CID 162859552
5,6,7-trihydroxy-8-methyl-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 162859552) has the molecular formula C16H14O8 and a molecular weight of 334.28 g/mol. Its IUPAC name is 5,6,7-trihydroxy-8-methyl-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 5,6,7-trihydroxy-8-methyl-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 162859552 |
| Molecular Formula | C16H14O8 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 5,6,7-trihydroxy-8-methyl-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | Cc1c(O)c(O)c(O)c2c1OC(c1cc(O)c(O)c(O)c1)CC2=O |
| InChI | InChI=1S/C16H14O8/c1-5-12(20)15(23)14(22)11-7(17)4-10(24-16(5)11)6-2-8(18)13(21)9(19)3-6/h2-3,10,18-23H,4H2,1H3 |
| InChIKey | ZXOFLKNBBIUJIN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|