C22H24O5 — CID 126659209
7-(2,3-dimethylbut-3-en-2-yloxy)-5-hydroxy-2-(4-hydroxyphenyl)-8-methyl-2,3-dihydrochromen-4-one (PubChem CID 126659209) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is 7-(2,3-dimethylbut-3-en-2-yloxy)-5-hydroxy-2-(4-hydroxyphenyl)-8-methyl-2,3-dihydrochromen-4-one.
| Compound Name | 7-(2,3-dimethylbut-3-en-2-yloxy)-5-hydroxy-2-(4-hydroxyphenyl)-8-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 126659209 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 7-(2,3-dimethylbut-3-en-2-yloxy)-5-hydroxy-2-(4-hydroxyphenyl)-8-methyl-2,3-dihydrochromen-4-one |
| SMILES | C=C(C)C(C)(C)Oc1cc(O)c2c(c1C)OC(c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C22H24O5/c1-12(2)22(4,5)27-18-10-16(24)20-17(25)11-19(26-21(20)13(18)3)14-6-8-15(23)9-7-14/h6-10,19,23-24H,1,11H2,2-5H3 |
| InChIKey | LPIUCPOVKILXFA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|