C22H22O8 — CID 162863077
[4-(7-acetyloxy-5-hydroxy-6,8-dimethyl-4-oxo-2,3-dihydrochromen-2-yl)-2-methoxyphenyl] acetate (PubChem CID 162863077) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is [4-(7-acetyloxy-5-hydroxy-6,8-dimethyl-4-oxo-2,3-dihydrochromen-2-yl)-2-methoxyphenyl] acetate.
| Compound Name | [4-(7-acetyloxy-5-hydroxy-6,8-dimethyl-4-oxo-2,3-dihydrochromen-2-yl)-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 162863077 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | [4-(7-acetyloxy-5-hydroxy-6,8-dimethyl-4-oxo-2,3-dihydrochromen-2-yl)-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C2CC(=O)c3c(O)c(C)c(OC(C)=O)c(C)c3O2)ccc1OC(C)=O |
| InChI | InChI=1S/C22H22O8/c1-10-20(26)19-15(25)9-17(30-22(19)11(2)21(10)29-13(4)24)14-6-7-16(28-12(3)23)18(8-14)27-5/h6-8,17,26H,9H2,1-5H3 |
| InChIKey | AOLRIXVCSLTLKV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|