C22H20O6 — CID 42506631
(2R)-2-(3-hydroxy-4-methoxyphenyl)-5,9,10-trimethyl-2,3-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 42506631) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is (2R)-2-(3-hydroxy-4-methoxyphenyl)-5,9,10-trimethyl-2,3-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (2R)-2-(3-hydroxy-4-methoxyphenyl)-5,9,10-trimethyl-2,3-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 42506631 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (2R)-2-(3-hydroxy-4-methoxyphenyl)-5,9,10-trimethyl-2,3-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc([C@H]2CC(=O)c3c(C)cc4oc(=O)c(C)c(C)c4c3O2)cc1O |
| InChI | InChI=1S/C22H20O6/c1-10-7-18-20(11(2)12(3)22(25)28-18)21-19(10)15(24)9-17(27-21)13-5-6-16(26-4)14(23)8-13/h5-8,17,23H,9H2,1-4H3/t17-/m1/s1 |
| InChIKey | HGGNIRHLMOHKMD-QGZVFWFLSA-N |
| XLogP | 4.14 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|