C24H24O7 — CID 42506712
(2S)-5,9,10-trimethyl-2-(2,3,4-trimethoxyphenyl)-2,3-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 42506712) has the molecular formula C24H24O7 and a molecular weight of 424.45 g/mol. Its IUPAC name is (2S)-5,9,10-trimethyl-2-(2,3,4-trimethoxyphenyl)-2,3-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (2S)-5,9,10-trimethyl-2-(2,3,4-trimethoxyphenyl)-2,3-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 42506712 |
| Molecular Formula | C24H24O7 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (2S)-5,9,10-trimethyl-2-(2,3,4-trimethoxyphenyl)-2,3-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc([C@@H]2CC(=O)c3c(C)cc4oc(=O)c(C)c(C)c4c3O2)c(OC)c1OC |
| InChI | InChI=1S/C24H24O7/c1-11-9-18-20(12(2)13(3)24(26)31-18)23-19(11)15(25)10-17(30-23)14-7-8-16(27-4)22(29-6)21(14)28-5/h7-9,17H,10H2,1-6H3/t17-/m0/s1 |
| InChIKey | KBDSPVXWTFCPKZ-KRWDZBQOSA-N |
| XLogP | 4.45 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|