C24H22O6 — CID 42507001
(2R)-2-(4-hydroxy-3-methoxyphenyl)-5-methyl-2,3,9,10,11,12-hexahydroisochromeno[3,4-h]chromene-4,8-dione (PubChem CID 42507001) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is (2R)-2-(4-hydroxy-3-methoxyphenyl)-5-methyl-2,3,9,10,11,12-hexahydroisochromeno[3,4-h]chromene-4,8-dione.
| Compound Name | (2R)-2-(4-hydroxy-3-methoxyphenyl)-5-methyl-2,3,9,10,11,12-hexahydroisochromeno[3,4-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 42507001 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (2R)-2-(4-hydroxy-3-methoxyphenyl)-5-methyl-2,3,9,10,11,12-hexahydroisochromeno[3,4-h]chromene-4,8-dione |
| SMILES | COc1cc([C@H]2CC(=O)c3c(C)cc4oc(=O)c5c(c4c3O2)CCCC5)ccc1O |
| InChI | InChI=1S/C24H22O6/c1-12-9-20-22(14-5-3-4-6-15(14)24(27)30-20)23-21(12)17(26)11-18(29-23)13-7-8-16(25)19(10-13)28-2/h7-10,18,25H,3-6,11H2,1-2H3/t18-/m1/s1 |
| InChIKey | BHIFHRARASPTJG-GOSISDBHSA-N |
| XLogP | 4.40 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|