C22H26O9 — CID 14332451
5,6,7-trimethoxy-2-(2,3,4,5-tetramethoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 14332451) has the molecular formula C22H26O9 and a molecular weight of 434.44 g/mol. Its IUPAC name is 5,6,7-trimethoxy-2-(2,3,4,5-tetramethoxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 5,6,7-trimethoxy-2-(2,3,4,5-tetramethoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 14332451 |
| Molecular Formula | C22H26O9 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 5,6,7-trimethoxy-2-(2,3,4,5-tetramethoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(C2CC(=O)c3c(cc(OC)c(OC)c3OC)O2)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C22H26O9/c1-24-15-8-11(18(26-3)22(30-7)20(15)28-5)13-9-12(23)17-14(31-13)10-16(25-2)19(27-4)21(17)29-6/h8,10,13H,9H2,1-7H3 |
| InChIKey | IRGHIHOWMUMHJU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |