C25H22BrNO6 — CID 155812717
3-bromo-N-[3-(5,6,7-trimethoxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl]benzamide (PubChem CID 155812717) has the molecular formula C25H22BrNO6 and a molecular weight of 512.36 g/mol. Its IUPAC name is 3-bromo-N-[3-(5,6,7-trimethoxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl]benzamide.
| Compound Name | 3-bromo-N-[3-(5,6,7-trimethoxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 155812717 |
| Molecular Formula | C25H22BrNO6 |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 3-bromo-N-[3-(5,6,7-trimethoxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl]benzamide |
| SMILES | COc1cc2c(c(OC)c1OC)C(=O)CC(c1cccc(NC(=O)c3cccc(Br)c3)c1)O2 |
| InChI | InChI=1S/C25H22BrNO6/c1-30-21-13-20-22(24(32-3)23(21)31-2)18(28)12-19(33-20)14-6-5-9-17(11-14)27-25(29)15-7-4-8-16(26)10-15/h4-11,13,19H,12H2,1-3H3,(H,27,29) |
| InChIKey | DLDFJUVZAONLJT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |