C20H15BrO3 — CID 10691352
3-(3-bromo-2-methoxyphenyl)-2,3-dihydrobenzo[f]chromen-1-one (PubChem CID 10691352) has the molecular formula C20H15BrO3 and a molecular weight of 383.24 g/mol. Its IUPAC name is 3-(3-bromo-2-methoxyphenyl)-2,3-dihydrobenzo[f]chromen-1-one.
| Compound Name | 3-(3-bromo-2-methoxyphenyl)-2,3-dihydrobenzo[f]chromen-1-one |
|---|---|
| PubChem CID | 10691352 |
| Molecular Formula | C20H15BrO3 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 3-(3-bromo-2-methoxyphenyl)-2,3-dihydrobenzo[f]chromen-1-one |
| SMILES | COc1c(Br)cccc1C1CC(=O)c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C20H15BrO3/c1-23-20-14(7-4-8-15(20)21)18-11-16(22)19-13-6-3-2-5-12(13)9-10-17(19)24-18/h2-10,18H,11H2,1H3 |
| InChIKey | JOFJVHRYKNFMCN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |