C13H10O5S — CID 88874360
5,6,7-trihydroxy-2-thiophen-3-yl-2,3-dihydrochromen-4-one (PubChem CID 88874360) has the molecular formula C13H10O5S and a molecular weight of 278.28 g/mol. Its IUPAC name is 5,6,7-trihydroxy-2-thiophen-3-yl-2,3-dihydrochromen-4-one.
| Compound Name | 5,6,7-trihydroxy-2-thiophen-3-yl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 88874360 |
| Molecular Formula | C13H10O5S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 5,6,7-trihydroxy-2-thiophen-3-yl-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ccsc2)Oc2cc(O)c(O)c(O)c21 |
| InChI | InChI=1S/C13H10O5S/c14-7-3-9(6-1-2-19-5-6)18-10-4-8(15)12(16)13(17)11(7)10/h1-2,4-5,9,15-17H,3H2 |
| InChIKey | KTQUALGXNVOUJF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|