C20H21NO6 — CID 134863979
5,7-dihydroxy-2-(4-hydroxyphenyl)-6-(morpholin-4-ylmethyl)-2,3-dihydrochromen-4-one (PubChem CID 134863979) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-(morpholin-4-ylmethyl)-2,3-dihydrochromen-4-one.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-(morpholin-4-ylmethyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 134863979 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-6-(morpholin-4-ylmethyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2ccc(O)cc2)Oc2cc(O)c(CN3CCOCC3)c(O)c21 |
| InChI | InChI=1S/C20H21NO6/c22-13-3-1-12(2-4-13)17-10-16(24)19-18(27-17)9-15(23)14(20(19)25)11-21-5-7-26-8-6-21/h1-4,9,17,22-23,25H,5-8,10-11H2 |
| InChIKey | YRJMEAWGZDCURQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|