C22H18O7 — CID 162858034
(2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(2-hydroxyphenyl)methyl]-2,3-dihydrochromen-4-one (PubChem CID 162858034) has the molecular formula C22H18O7 and a molecular weight of 394.38 g/mol. Its IUPAC name is (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(2-hydroxyphenyl)methyl]-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(2-hydroxyphenyl)methyl]-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 162858034 |
| Molecular Formula | C22H18O7 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(2-hydroxyphenyl)methyl]-2,3-dihydrochromen-4-one |
| SMILES | O=C1C[C@@H](c2ccc(O)c(O)c2)Oc2cc(O)c(Cc3ccccc3O)c(O)c21 |
| InChI | InChI=1S/C22H18O7/c23-14-4-2-1-3-11(14)7-13-16(25)9-20-21(22(13)28)18(27)10-19(29-20)12-5-6-15(24)17(26)8-12/h1-6,8-9,19,23-26,28H,7,10H2/t19-/m0/s1 |
| InChIKey | ATUPNEOKMQLOLF-IBGZPJMESA-N |
| XLogP | 3.51 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|