C23H22O11 — CID 89055065
[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-3-yl] 3,5-dihydroxy-4-methylcyclohexene-1-carboxylate (PubChem CID 89055065) has the molecular formula C23H22O11 and a molecular weight of 474.42 g/mol. Its IUPAC name is [5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-3-yl] 3,5-dihydroxy-4-methylcyclohexene-1-carboxylate.
| Compound Name | [5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-3-yl] 3,5-dihydroxy-4-methylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 89055065 |
| Molecular Formula | C23H22O11 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-3-yl] 3,5-dihydroxy-4-methylcyclohexene-1-carboxylate |
| SMILES | CC1C(O)C=C(C(=O)OC2C(=O)c3c(O)cc(O)cc3OC2c2cc(O)c(O)c(O)c2)CC1O |
| InChI | InChI=1S/C23H22O11/c1-8-12(25)4-10(5-13(8)26)23(32)34-22-20(31)18-14(27)6-11(24)7-17(18)33-21(22)9-2-15(28)19(30)16(29)3-9/h2-4,6-8,12-13,21-22,24-30H,5H2,1H3 |
| InChIKey | MGKHCNWAOZAVFV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|