C22H16O11 — CID 162946467
[7-hydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 162946467) has the molecular formula C22H16O11 and a molecular weight of 456.36 g/mol. Its IUPAC name is [7-hydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [7-hydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 162946467 |
| Molecular Formula | C22H16O11 |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | [7-hydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-2,3-dihydrochromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OC1C(=O)c2ccc(O)cc2OC1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C22H16O11/c23-10-1-2-11-16(7-10)32-20(8-3-12(24)18(29)13(25)4-8)21(17(11)28)33-22(31)9-5-14(26)19(30)15(27)6-9/h1-7,20-21,23-27,29-30H |
| InChIKey | VFSWRBJYBQXUTE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|