C10H10O6 — CID 163065491
(3S)-5,6,7-trihydroxy-3-methoxy-4-methyl-3H-2-benzofuran-1-one (PubChem CID 163065491) has the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. Its IUPAC name is (3S)-5,6,7-trihydroxy-3-methoxy-4-methyl-3H-2-benzofuran-1-one.
| Compound Name | (3S)-5,6,7-trihydroxy-3-methoxy-4-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 163065491 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (3S)-5,6,7-trihydroxy-3-methoxy-4-methyl-3H-2-benzofuran-1-one |
| SMILES | CO[C@H]1OC(=O)c2c(O)c(O)c(O)c(C)c21 |
| InChI | InChI=1S/C10H10O6/c1-3-4-5(7(12)8(13)6(3)11)9(14)16-10(4)15-2/h10-13H,1-2H3/t10-/m0/s1 |
| InChIKey | PZBSSTRXBNWBNX-JTQLQIEISA-N |
| XLogP | 0.93 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|