C18H14O9 — CID 162941230
(17R)-4,13,17-trihydroxy-5-methoxy-7,12-dimethyl-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-9,15-dione (PubChem CID 162941230) has the molecular formula C18H14O9 and a molecular weight of 374.30 g/mol. Its IUPAC name is (17R)-4,13,17-trihydroxy-5-methoxy-7,12-dimethyl-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-9,15-dione.
| Compound Name | (17R)-4,13,17-trihydroxy-5-methoxy-7,12-dimethyl-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-9,15-dione |
|---|---|
| PubChem CID | 162941230 |
| Molecular Formula | C18H14O9 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (17R)-4,13,17-trihydroxy-5-methoxy-7,12-dimethyl-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-9,15-dione |
| SMILES | COc1cc(C)c2c(c1O)Oc1c(c(C)c(O)c3c1[C@H](O)OC3=O)OC2=O |
| InChI | InChI=1S/C18H14O9/c1-5-4-7(24-3)12(20)14-8(5)16(21)26-13-6(2)11(19)9-10(15(13)25-14)18(23)27-17(9)22/h4,18-20,23H,1-3H3/t18-/m1/s1 |
| InChIKey | CAIDWUCHPKFSPM-GOSISDBHSA-N |
| XLogP | 2.21 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|