C18H12O8 — CID 118343578
13,17-dihydroxy-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3,5,7,12,14(18)-hexaene-4-carbaldehyde (PubChem CID 118343578) has the molecular formula C18H12O8 and a molecular weight of 356.29 g/mol. Its IUPAC name is 13,17-dihydroxy-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3,5,7,12,14(18)-hexaene-4-carbaldehyde.
| Compound Name | 13,17-dihydroxy-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3,5,7,12,14(18)-hexaene-4-carbaldehyde |
|---|---|
| PubChem CID | 118343578 |
| Molecular Formula | C18H12O8 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 13,17-dihydroxy-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3,5,7,12,14(18)-hexaene-4-carbaldehyde |
| SMILES | Cc1ccc(C=O)c2c1C(=O)Oc1c(C)c(O)c3c(c1O2)C(O)OC3=O |
| InChI | InChI=1S/C18H12O8/c1-6-3-4-8(5-19)14-9(6)16(21)25-13-7(2)12(20)10-11(15(13)24-14)18(23)26-17(10)22/h3-5,18,20,23H,1-2H3 |
| InChIKey | DFYGRMNBGXGWGE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|