C13H12O5 — CID 162927047
(4S)-6,8-dihydroxy-4,7-dimethyl-3-methylidene-1-oxo-4H-isochromene-5-carbaldehyde (PubChem CID 162927047) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is (4S)-6,8-dihydroxy-4,7-dimethyl-3-methylidene-1-oxo-4H-isochromene-5-carbaldehyde.
| Compound Name | (4S)-6,8-dihydroxy-4,7-dimethyl-3-methylidene-1-oxo-4H-isochromene-5-carbaldehyde |
|---|---|
| PubChem CID | 162927047 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (4S)-6,8-dihydroxy-4,7-dimethyl-3-methylidene-1-oxo-4H-isochromene-5-carbaldehyde |
| SMILES | C=C1OC(=O)c2c(O)c(C)c(O)c(C=O)c2[C@@H]1C |
| InChI | InChI=1S/C13H12O5/c1-5-7(3)18-13(17)10-9(5)8(4-14)11(15)6(2)12(10)16/h4-5,15-16H,3H2,1-2H3/t5-/m1/s1 |
| InChIKey | MKXPEMIYFLKLRY-RXMQYKEDSA-N |
| XLogP | 2.01 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|