C18H15ClO6 — CID 579118
8-chloro-1-hydroxy-9-methoxy-3,7,10-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carbaldehyde (PubChem CID 579118) has the molecular formula C18H15ClO6 and a molecular weight of 362.77 g/mol. Its IUPAC name is 8-chloro-1-hydroxy-9-methoxy-3,7,10-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carbaldehyde.
| Compound Name | 8-chloro-1-hydroxy-9-methoxy-3,7,10-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carbaldehyde |
|---|---|
| PubChem CID | 579118 |
| Molecular Formula | C18H15ClO6 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 8-chloro-1-hydroxy-9-methoxy-3,7,10-trimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carbaldehyde |
| SMILES | COc1c(C)c2c(c(C)c1Cl)C(=O)Oc1cc(C)c(C=O)c(O)c1O2 |
| InChI | InChI=1S/C18H15ClO6/c1-7-5-11-17(14(21)10(7)6-20)25-15-9(3)16(23-4)13(19)8(2)12(15)18(22)24-11/h5-6,21H,1-4H3 |
| InChIKey | GXLRAMMQUGVYLZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|