C18H17ClO5 — CID 14825968
8-chloro-9-hydroxy-3-methoxy-1,4,7,10-tetramethylbenzo[b][1,4]benzodioxepin-6-one (PubChem CID 14825968) has the molecular formula C18H17ClO5 and a molecular weight of 348.78 g/mol. Its IUPAC name is 8-chloro-9-hydroxy-3-methoxy-1,4,7,10-tetramethylbenzo[b][1,4]benzodioxepin-6-one.
| Compound Name | 8-chloro-9-hydroxy-3-methoxy-1,4,7,10-tetramethylbenzo[b][1,4]benzodioxepin-6-one |
|---|---|
| PubChem CID | 14825968 |
| Molecular Formula | C18H17ClO5 |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 8-chloro-9-hydroxy-3-methoxy-1,4,7,10-tetramethylbenzo[b][1,4]benzodioxepin-6-one |
| SMILES | COc1cc(C)c2c(c1C)OC(=O)c1c(C)c(Cl)c(O)c(C)c1O2 |
| InChI | InChI=1S/C18H17ClO5/c1-7-6-11(22-5)8(2)17-15(7)23-16-10(4)14(20)13(19)9(3)12(16)18(21)24-17/h6,20H,1-5H3 |
| InChIKey | UAKCXRFJSDHUDM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|