C18H18O6 — CID 122397322
4,7-dihydroxy-12-methoxy-4,5,5,14-tetramethyl-3,10-dioxatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),7,11,13-pentaen-9-one (PubChem CID 122397322) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is 4,7-dihydroxy-12-methoxy-4,5,5,14-tetramethyl-3,10-dioxatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),7,11,13-pentaen-9-one.
| Compound Name | 4,7-dihydroxy-12-methoxy-4,5,5,14-tetramethyl-3,10-dioxatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),7,11,13-pentaen-9-one |
|---|---|
| PubChem CID | 122397322 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4,7-dihydroxy-12-methoxy-4,5,5,14-tetramethyl-3,10-dioxatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),7,11,13-pentaen-9-one |
| SMILES | COc1cc(C)c2c3c(c(O)c4c2c1OC4=O)C(C)(C)C(C)(O)O3 |
| InChI | InChI=1S/C18H18O6/c1-7-6-8(22-5)14-10-9(7)15-12(13(19)11(10)16(20)23-14)17(2,3)18(4,21)24-15/h6,19,21H,1-5H3 |
| InChIKey | UMPNEPMXVGZSAN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|