C17H16O5 — CID 135972628
2,4-dihydroxy-3,7-dimethoxy-6,9-dimethylphenalen-1-one (PubChem CID 135972628) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2,4-dihydroxy-3,7-dimethoxy-6,9-dimethylphenalen-1-one.
| Compound Name | 2,4-dihydroxy-3,7-dimethoxy-6,9-dimethylphenalen-1-one |
|---|---|
| PubChem CID | 135972628 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2,4-dihydroxy-3,7-dimethoxy-6,9-dimethylphenalen-1-one |
| SMILES | COC1=C(O)C(=O)c2c(C)cc(OC)c3c(C)cc(O)c1c23 |
| InChI | InChI=1S/C17H16O5/c1-7-5-9(18)13-14-11(7)10(21-3)6-8(2)12(14)15(19)16(20)17(13)22-4/h5-6,18,20H,1-4H3 |
| InChIKey | ADCQIHNFERJWRE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'naphth_ene_one_A(1)', 'substructure': 'N/A'} |
|---|