C17H16O6 — CID 102189817
3-hydroxy-4,6,7,9-tetramethoxyphenalen-1-one (PubChem CID 102189817) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is 3-hydroxy-4,6,7,9-tetramethoxyphenalen-1-one.
| Compound Name | 3-hydroxy-4,6,7,9-tetramethoxyphenalen-1-one |
|---|---|
| PubChem CID | 102189817 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-hydroxy-4,6,7,9-tetramethoxyphenalen-1-one |
| SMILES | COc1cc(OC)c2c(OC)cc(OC)c3c2c1C(=O)C=C3O |
| InChI | InChI=1S/C17H16O6/c1-20-10-6-12(22-3)16-13(23-4)7-11(21-2)15-9(19)5-8(18)14(10)17(15)16/h5-7,18H,1-4H3 |
| InChIKey | VDWZBKRPRSBJFF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |