C28H22O12 — CID 135545220
dimethyl 2,11-dihydroxy-4,6,7,9-tetramethoxy-3,10-dioxoperylene-1,12-dicarboxylate (PubChem CID 135545220) has the molecular formula C28H22O12 and a molecular weight of 550.47 g/mol. Its IUPAC name is dimethyl 2,11-dihydroxy-4,6,7,9-tetramethoxy-3,10-dioxoperylene-1,12-dicarboxylate.
| Compound Name | dimethyl 2,11-dihydroxy-4,6,7,9-tetramethoxy-3,10-dioxoperylene-1,12-dicarboxylate |
|---|---|
| PubChem CID | 135545220 |
| Molecular Formula | C28H22O12 |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | dimethyl 2,11-dihydroxy-4,6,7,9-tetramethoxy-3,10-dioxoperylene-1,12-dicarboxylate |
| SMILES | COC(=O)c1c(O)c(=O)c2c(OC)cc(OC)c3c4c(OC)cc(OC)c5c(=O)c(O)c(C(=O)OC)c(c1c23)c54 |
| InChI | InChI=1S/C28H22O12/c1-35-9-7-11(37-3)15-17-13(9)14-10(36-2)8-12(38-4)16-18(14)20(22(28(34)40-6)26(32)24(16)30)19(17)21(27(33)39-5)25(31)23(15)29/h7-8,31-32H,1-6H3 |
| InChIKey | APRODJDUOMJVTO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|