C13H8O6 — CID 125489226
3,4,6,7,9-pentahydroxyphenalen-1-one (PubChem CID 125489226) has the molecular formula C13H8O6 and a molecular weight of 260.20 g/mol. Its IUPAC name is 3,4,6,7,9-pentahydroxyphenalen-1-one.
| Compound Name | 3,4,6,7,9-pentahydroxyphenalen-1-one |
|---|---|
| PubChem CID | 125489226 |
| Molecular Formula | C13H8O6 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 3,4,6,7,9-pentahydroxyphenalen-1-one |
| SMILES | O=C1C=C(O)c2c(O)cc(O)c3c(O)cc(O)c1c23 |
| InChI | InChI=1S/C13H8O6/c14-4-1-5(15)11-7(17)3-9(19)12-8(18)2-6(16)10(4)13(11)12/h1-3,14-18H |
| InChIKey | IXKHVRYPGBLTEA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |