C6H4FeO5 — CID 175482341
iron;2,3,5-trihydroxycyclohexa-2,5-diene-1,4-dione (PubChem CID 175482341) has the molecular formula C6H4FeO5 and a molecular weight of 211.94 g/mol. Its IUPAC name is iron;2,3,5-trihydroxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | iron;2,3,5-trihydroxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 175482341 |
| Molecular Formula | C6H4FeO5 |
| Molecular Weight | 211.94 g/mol |
| Exact Mass | 211.94 |
| IUPAC Name | iron;2,3,5-trihydroxycyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(O)C(=O)C(O)=C1O.[Fe] |
| InChI | InChI=1S/C6H4O5.Fe/c7-2-1-3(8)5(10)6(11)4(2)9;/h1,7,10-11H; |
| InChIKey | KVUNOEMTYXDEJX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.94 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|