C9H8O3 — CID 130031115
7-hydroxy-2,3-dihydro-1H-indene-4,5-dione (PubChem CID 130031115) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is 7-hydroxy-2,3-dihydro-1H-indene-4,5-dione.
| Compound Name | 7-hydroxy-2,3-dihydro-1H-indene-4,5-dione |
|---|---|
| PubChem CID | 130031115 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 7-hydroxy-2,3-dihydro-1H-indene-4,5-dione |
| SMILES | O=C1C=C(O)C2=C(CCC2)C1=O |
| InChI | InChI=1S/C9H8O3/c10-7-4-8(11)9(12)6-3-1-2-5(6)7/h4,10H,1-3H2 |
| InChIKey | XIRBMNZZEKSXSF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|