C20H12O6 — CID 160751652
4-hydroxynaphthalene-1,2-dione;5-hydroxynaphthalene-1,2-dione (PubChem CID 160751652) has the molecular formula C20H12O6 and a molecular weight of 348.31 g/mol. Its IUPAC name is 4-hydroxynaphthalene-1,2-dione;5-hydroxynaphthalene-1,2-dione.
| Compound Name | 4-hydroxynaphthalene-1,2-dione;5-hydroxynaphthalene-1,2-dione |
|---|---|
| PubChem CID | 160751652 |
| Molecular Formula | C20H12O6 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 4-hydroxynaphthalene-1,2-dione;5-hydroxynaphthalene-1,2-dione |
| SMILES | O=C1C=C(O)c2ccccc2C1=O.O=C1C=Cc2c(O)cccc2C1=O |
| InChI | InChI=1S/2C10H6O3/c11-8-3-1-2-7-6(8)4-5-9(12)10(7)13;11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h2*1-5,11H |
| InChIKey | RWXCDXYGGPWXND-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|