C16H14N2O7S-2 — CID 56967750
4,6-dimethyl-1H-pyrimidin-2-one;4-hydroxynaphthalene-1,2-dione;sulfite (PubChem CID 56967750) has the molecular formula C16H14N2O7S-2 and a molecular weight of 378.36 g/mol. Its IUPAC name is 4,6-dimethyl-1H-pyrimidin-2-one;4-hydroxynaphthalene-1,2-dione;sulfite.
| Compound Name | 4,6-dimethyl-1H-pyrimidin-2-one;4-hydroxynaphthalene-1,2-dione;sulfite |
|---|---|
| PubChem CID | 56967750 |
| Molecular Formula | C16H14N2O7S-2 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 4,6-dimethyl-1H-pyrimidin-2-one;4-hydroxynaphthalene-1,2-dione;sulfite |
| SMILES | Cc1cc(C)[nH]c(=O)n1.O=C1C=C(O)c2ccccc2C1=O.O=S([O-])[O-] |
| InChI | InChI=1S/C10H6O3.C6H8N2O.H2O3S/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8;1-4-3-5(2)8-6(9)7-4;1-4(2)3/h1-5,11H;3H,1-2H3,(H,7,8,9);(H2,1,2,3)/p-2 |
| InChIKey | FVEDVWCKKFLOTQ-UHFFFAOYSA-L |
| XLogP | 0.73 |
| TPSA | 163.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|