C15H11N3O3 — CID 135827465
6-(2-hydroxyphenyl)-4-phenoxy-1H-1,3,5-triazin-2-one (PubChem CID 135827465) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 6-(2-hydroxyphenyl)-4-phenoxy-1H-1,3,5-triazin-2-one.
| Compound Name | 6-(2-hydroxyphenyl)-4-phenoxy-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135827465 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 6-(2-hydroxyphenyl)-4-phenoxy-1H-1,3,5-triazin-2-one |
| SMILES | O=c1nc(Oc2ccccc2)nc(-c2ccccc2O)[nH]1 |
| InChI | InChI=1S/C15H11N3O3/c19-12-9-5-4-8-11(12)13-16-14(20)18-15(17-13)21-10-6-2-1-3-7-10/h1-9,19H,(H,16,17,18,20) |
| InChIKey | WDZJAAUSCWZVTL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |