C15H11N3O2 — CID 156780127
6-(4-hydroxyphenyl)-4-phenyl-1H-1,3,5-triazin-2-one (PubChem CID 156780127) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 6-(4-hydroxyphenyl)-4-phenyl-1H-1,3,5-triazin-2-one.
| Compound Name | 6-(4-hydroxyphenyl)-4-phenyl-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 156780127 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 6-(4-hydroxyphenyl)-4-phenyl-1H-1,3,5-triazin-2-one |
| SMILES | O=c1nc(-c2ccccc2)nc(-c2ccc(O)cc2)[nH]1 |
| InChI | InChI=1S/C15H11N3O2/c19-12-8-6-11(7-9-12)14-16-13(17-15(20)18-14)10-4-2-1-3-5-10/h1-9,19H,(H,16,17,18,20) |
| InChIKey | CFHORIXTRCICST-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |