C16H21N3O — CID 162031267
but-2-yne;ethane;6-methyl-4-phenyl-1H-1,3,5-triazin-2-one (PubChem CID 162031267) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is but-2-yne;ethane;6-methyl-4-phenyl-1H-1,3,5-triazin-2-one.
| Compound Name | but-2-yne;ethane;6-methyl-4-phenyl-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 162031267 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | but-2-yne;ethane;6-methyl-4-phenyl-1H-1,3,5-triazin-2-one |
| SMILES | CC.CC#CC.Cc1nc(-c2ccccc2)nc(=O)[nH]1 |
| InChI | InChI=1S/C10H9N3O.C4H6.C2H6/c1-7-11-9(13-10(14)12-7)8-5-3-2-4-6-8;1-3-4-2;1-2/h2-6H,1H3,(H,11,12,13,14);1-2H3;1-2H3 |
| InChIKey | YWAYWZGIIXFBBC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|