C18H14N4 — CID 11254681
8-methyl-2,6-diphenyl-7H-purine (PubChem CID 11254681) has the molecular formula C18H14N4 and a molecular weight of 286.34 g/mol. Its IUPAC name is 8-methyl-2,6-diphenyl-7H-purine.
| Compound Name | 8-methyl-2,6-diphenyl-7H-purine |
|---|---|
| PubChem CID | 11254681 |
| Molecular Formula | C18H14N4 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 8-methyl-2,6-diphenyl-7H-purine |
| SMILES | Cc1nc2nc(-c3ccccc3)nc(-c3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C18H14N4/c1-12-19-16-15(13-8-4-2-5-9-13)21-17(22-18(16)20-12)14-10-6-3-7-11-14/h2-11H,1H3,(H,19,20,21,22) |
| InChIKey | QFGFGDRSURCZBU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |