C18H14N2O — CID 14878093
4-methyl-2,6-diphenylpyrimidine-5-carbaldehyde (PubChem CID 14878093) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-methyl-2,6-diphenylpyrimidine-5-carbaldehyde.
| Compound Name | 4-methyl-2,6-diphenylpyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 14878093 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-methyl-2,6-diphenylpyrimidine-5-carbaldehyde |
| SMILES | Cc1nc(-c2ccccc2)nc(-c2ccccc2)c1C=O |
| InChI | InChI=1S/C18H14N2O/c1-13-16(12-21)17(14-8-4-2-5-9-14)20-18(19-13)15-10-6-3-7-11-15/h2-12H,1H3 |
| InChIKey | OLOWJTUQJRYMBA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|