C18H13FN2O — CID 138970267
1-(5-fluoro-2,6-diphenylpyrimidin-4-yl)ethanone (PubChem CID 138970267) has the molecular formula C18H13FN2O and a molecular weight of 292.31 g/mol. Its IUPAC name is 1-(5-fluoro-2,6-diphenylpyrimidin-4-yl)ethanone.
| Compound Name | 1-(5-fluoro-2,6-diphenylpyrimidin-4-yl)ethanone |
|---|---|
| PubChem CID | 138970267 |
| Molecular Formula | C18H13FN2O |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-(5-fluoro-2,6-diphenylpyrimidin-4-yl)ethanone |
| SMILES | CC(=O)c1nc(-c2ccccc2)nc(-c2ccccc2)c1F |
| InChI | InChI=1S/C18H13FN2O/c1-12(22)16-15(19)17(13-8-4-2-5-9-13)21-18(20-16)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | NNYZGCZEKDZPPV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |