C29H20N2O — CID 12782476
phenyl-(2,4,6-triphenylpyrimidin-5-yl)methanone (PubChem CID 12782476) has the molecular formula C29H20N2O and a molecular weight of 412.49 g/mol. Its IUPAC name is phenyl-(2,4,6-triphenylpyrimidin-5-yl)methanone.
| Compound Name | phenyl-(2,4,6-triphenylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 12782476 |
| Molecular Formula | C29H20N2O |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | phenyl-(2,4,6-triphenylpyrimidin-5-yl)methanone |
| SMILES | O=C(c1ccccc1)c1c(-c2ccccc2)nc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C29H20N2O/c32-28(23-17-9-3-10-18-23)25-26(21-13-5-1-6-14-21)30-29(24-19-11-4-12-20-24)31-27(25)22-15-7-2-8-16-22/h1-20H |
| InChIKey | OAVUUATURPPANM-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |