C23H15ClN2O — CID 10571236
(3-chloro-5,6-diphenylpyridazin-4-yl)-phenylmethanone (PubChem CID 10571236) has the molecular formula C23H15ClN2O and a molecular weight of 370.84 g/mol. Its IUPAC name is (3-chloro-5,6-diphenylpyridazin-4-yl)-phenylmethanone.
| Compound Name | (3-chloro-5,6-diphenylpyridazin-4-yl)-phenylmethanone |
|---|---|
| PubChem CID | 10571236 |
| Molecular Formula | C23H15ClN2O |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (3-chloro-5,6-diphenylpyridazin-4-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(Cl)nnc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C23H15ClN2O/c24-23-20(22(27)18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)21(25-26-23)17-12-6-2-7-13-17/h1-15H |
| InChIKey | KRQPVJGWFGIWKR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |