C32H20ClN3OS — CID 25146454
[5-[(4-chlorophenyl)methylideneamino]-3,4-diphenylthieno[2,3-c]pyridazin-6-yl]-phenylmethanone (PubChem CID 25146454) has the molecular formula C32H20ClN3OS and a molecular weight of 530.05 g/mol. Its IUPAC name is [5-[(4-chlorophenyl)methylideneamino]-3,4-diphenylthieno[2,3-c]pyridazin-6-yl]-phenylmethanone.
| Compound Name | [5-[(4-chlorophenyl)methylideneamino]-3,4-diphenylthieno[2,3-c]pyridazin-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 25146454 |
| Molecular Formula | C32H20ClN3OS |
| Molecular Weight | 530.05 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | [5-[(4-chlorophenyl)methylideneamino]-3,4-diphenylthieno[2,3-c]pyridazin-6-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1sc2nnc(-c3ccccc3)c(-c3ccccc3)c2c1/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H20ClN3OS/c33-25-18-16-21(17-19-25)20-34-29-27-26(22-10-4-1-5-11-22)28(23-12-6-2-7-13-23)35-36-32(27)38-31(29)30(37)24-14-8-3-9-15-24/h1-20H/b34-20+ |
| InChIKey | IZVVZXCJZXFNHR-QXUDOOCXSA-N |
| XLogP | 8.66 |
| TPSA | 55.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.05 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|