About benzamide;5,6-diphenyltetrazine
benzamide;5,6-diphenyltetrazine (PubChem CID 174808864) has the molecular formula C21H17N5O
and a molecular weight of 355.40 g/mol. Its IUPAC name is benzamide;5,6-diphenyltetrazine.
Molecular Properties
| Compound Name | benzamide;5,6-diphenyltetrazine |
| PubChem CID | 174808864 |
| Molecular Formula | C21H17N5O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | benzamide;5,6-diphenyltetrazine |
| SMILES | NC(=O)c1ccccc1.c1ccc(-c2nnnnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H10N4.C7H7NO/c1-3-7-11(8-4-1)13-14(16-18-17-15-13)12-9-5-2-6-10-12;8-7(9)6-4-2-1-3-5-6/h1-10H;1-5H,(H2,8,9) |
| InChIKey | SEFWWWFOXONYSS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzamide;5,6-diphenyltetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;5,6-diphenyltetrazine?
The IUPAC name of benzamide;5,6-diphenyltetrazine (CID 174808864) is benzamide;5,6-diphenyltetrazine.
What is the SMILES notation for benzamide;5,6-diphenyltetrazine?
The canonical SMILES for benzamide;5,6-diphenyltetrazine is NC(=O)c1ccccc1.c1ccc(-c2nnnnc2-c2ccccc2)cc1.
What is the InChIKey of benzamide;5,6-diphenyltetrazine?
The InChIKey is SEFWWWFOXONYSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4.C7H7NO/c1-3-7-11(8-4-1)13-14(16-18-17-15-13)12-9-5-2-6-10-12;8-7(9)6-4-2-1-3-5-6/h1-10H;1-5H,(H2,8,9).
What are the key properties of benzamide;5,6-diphenyltetrazine?
benzamide;5,6-diphenyltetrazine has a molecular weight of 355.40 g/mol, XLogP of 3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;5,6-diphenyltetrazine is sourced from PubChem (CID 174808864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).