C17H14N2O — CID 135012179
4-methyl-2,6-diphenylpyrimidin-5-ol (PubChem CID 135012179) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-methyl-2,6-diphenylpyrimidin-5-ol.
| Compound Name | 4-methyl-2,6-diphenylpyrimidin-5-ol |
|---|---|
| PubChem CID | 135012179 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-methyl-2,6-diphenylpyrimidin-5-ol |
| SMILES | Cc1nc(-c2ccccc2)nc(-c2ccccc2)c1O |
| InChI | InChI=1S/C17H14N2O/c1-12-16(20)15(13-8-4-2-5-9-13)19-17(18-12)14-10-6-3-7-11-14/h2-11,20H,1H3 |
| InChIKey | IEATWHHIYXFYIJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |