C18H11Cl2N2O2- — CID 86606140
4-(2,4-dichlorophenyl)-6-methyl-2-phenylpyrimidine-5-carboxylate (PubChem CID 86606140) has the molecular formula C18H11Cl2N2O2- and a molecular weight of 358.20 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-6-methyl-2-phenylpyrimidine-5-carboxylate.
| Compound Name | 4-(2,4-dichlorophenyl)-6-methyl-2-phenylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 86606140 |
| Molecular Formula | C18H11Cl2N2O2- |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-6-methyl-2-phenylpyrimidine-5-carboxylate |
| SMILES | Cc1nc(-c2ccccc2)nc(-c2ccc(Cl)cc2Cl)c1C(=O)[O-] |
| InChI | InChI=1S/C18H12Cl2N2O2/c1-10-15(18(23)24)16(13-8-7-12(19)9-14(13)20)22-17(21-10)11-5-3-2-4-6-11/h2-9H,1H3,(H,23,24)/p-1 |
| InChIKey | KKFBOHKMYUOBJA-UHFFFAOYSA-M |
| XLogP | 3.79 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |