C19H18N2O — CID 10946202
4-ethoxy-5-methyl-2,6-diphenylpyrimidine (PubChem CID 10946202) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-ethoxy-5-methyl-2,6-diphenylpyrimidine.
| Compound Name | 4-ethoxy-5-methyl-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 10946202 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 4-ethoxy-5-methyl-2,6-diphenylpyrimidine |
| SMILES | CCOc1nc(-c2ccccc2)nc(-c2ccccc2)c1C |
| InChI | InChI=1S/C19H18N2O/c1-3-22-19-14(2)17(15-10-6-4-7-11-15)20-18(21-19)16-12-8-5-9-13-16/h4-13H,3H2,1-2H3 |
| InChIKey | DBTRXMIJVJEXKM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |