C20H19NO2 — CID 90076394
2-ethoxy-3-methoxy-5,6-diphenylpyridine (PubChem CID 90076394) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-ethoxy-3-methoxy-5,6-diphenylpyridine.
| Compound Name | 2-ethoxy-3-methoxy-5,6-diphenylpyridine |
|---|---|
| PubChem CID | 90076394 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-ethoxy-3-methoxy-5,6-diphenylpyridine |
| SMILES | CCOc1nc(-c2ccccc2)c(-c2ccccc2)cc1OC |
| InChI | InChI=1S/C20H19NO2/c1-3-23-20-18(22-2)14-17(15-10-6-4-7-11-15)19(21-20)16-12-8-5-9-13-16/h4-14H,3H2,1-2H3 |
| InChIKey | OCAMTPXVGWWTPP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |