C14H14N2O2 — CID 24827747
4-ethoxy-2-phenyl-5,6-dihydrofuro[2,3-d]pyrimidine (PubChem CID 24827747) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-ethoxy-2-phenyl-5,6-dihydrofuro[2,3-d]pyrimidine.
| Compound Name | 4-ethoxy-2-phenyl-5,6-dihydrofuro[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 24827747 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-ethoxy-2-phenyl-5,6-dihydrofuro[2,3-d]pyrimidine |
| SMILES | CCOc1nc(-c2ccccc2)nc2c1CCO2 |
| InChI | InChI=1S/C14H14N2O2/c1-2-17-13-11-8-9-18-14(11)16-12(15-13)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | MLCGMIYBLRQUSF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |