C12H9ClN2O — CID 10561592
4-chloro-2-phenyl-5,6-dihydrofuro[2,3-d]pyrimidine (PubChem CID 10561592) has the molecular formula C12H9ClN2O and a molecular weight of 232.67 g/mol. Its IUPAC name is 4-chloro-2-phenyl-5,6-dihydrofuro[2,3-d]pyrimidine.
| Compound Name | 4-chloro-2-phenyl-5,6-dihydrofuro[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 10561592 |
| Molecular Formula | C12H9ClN2O |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 4-chloro-2-phenyl-5,6-dihydrofuro[2,3-d]pyrimidine |
| SMILES | Clc1nc(-c2ccccc2)nc2c1CCO2 |
| InChI | InChI=1S/C12H9ClN2O/c13-10-9-6-7-16-12(9)15-11(14-10)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | BBRGQGFQHQPRBA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |